C19H16N2O3 — CID 21232723
[2-(naphthalen-2-ylamino)-2-oxoethyl] 3-aminobenzoate (PubChem CID 21232723) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is [2-(naphthalen-2-ylamino)-2-oxoethyl] 3-aminobenzoate.
| Compound Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] 3-aminobenzoate |
|---|---|
| PubChem CID | 21232723 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] 3-aminobenzoate |
| SMILES | Nc1cccc(C(=O)OCC(=O)Nc2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C19H16N2O3/c20-16-7-3-6-15(10-16)19(23)24-12-18(22)21-17-9-8-13-4-1-2-5-14(13)11-17/h1-11H,12,20H2,(H,21,22) |
| InChIKey | CXYQJDJPHZREAB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|