C21H21N5O5S — CID 25049242
[2-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]anilino]-2-oxoethyl] 3-aminobenzoate (PubChem CID 25049242) has the molecular formula C21H21N5O5S and a molecular weight of 455.50 g/mol. Its IUPAC name is [2-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]anilino]-2-oxoethyl] 3-aminobenzoate.
| Compound Name | [2-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]anilino]-2-oxoethyl] 3-aminobenzoate |
|---|---|
| PubChem CID | 25049242 |
| Molecular Formula | C21H21N5O5S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | [2-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]anilino]-2-oxoethyl] 3-aminobenzoate |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(NC(=O)COC(=O)c3cccc(N)c3)cc2)n1 |
| InChI | InChI=1S/C21H21N5O5S/c1-13-10-14(2)24-21(23-13)26-32(29,30)18-8-6-17(7-9-18)25-19(27)12-31-20(28)15-4-3-5-16(22)11-15/h3-11H,12,22H2,1-2H3,(H,25,27)(H,23,24,26) |
| InChIKey | NIJJCWDWZJMBGA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 153.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|