About [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-amino-5-bromobenzoate
[2-(naphthalen-2-ylamino)-2-oxoethyl] 2-amino-5-bromobenzoate (PubChem CID 7149341) has the molecular formula C19H15BrN2O3
and a molecular weight of 399.24 g/mol. Its IUPAC name is [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-amino-5-bromobenzoate.
Molecular Properties
| Compound Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-amino-5-bromobenzoate |
| PubChem CID | 7149341 |
| Molecular Formula | C19H15BrN2O3 |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-amino-5-bromobenzoate |
| SMILES | Nc1ccc(Br)cc1C(=O)OCC(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H15BrN2O3/c20-14-6-8-17(21)16(10-14)19(24)25-11-18(23)22-15-7-5-12-3-1-2-4-13(12)9-15/h1-10H,11,21H2,(H,22,23) |
| InChIKey | WPKUXPYKGKQLDP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-amino-5-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-amino-5-bromobenzoate?
The IUPAC name of [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-amino-5-bromobenzoate (CID 7149341) is [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-amino-5-bromobenzoate.
What is the SMILES notation for [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-amino-5-bromobenzoate?
The canonical SMILES for [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-amino-5-bromobenzoate is Nc1ccc(Br)cc1C(=O)OCC(=O)Nc1ccc2ccccc2c1.
What is the InChIKey of [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-amino-5-bromobenzoate?
The InChIKey is WPKUXPYKGKQLDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15BrN2O3/c20-14-6-8-17(21)16(10-14)19(24)25-11-18(23)22-15-7-5-12-3-1-2-4-13(12)9-15/h1-10H,11,21H2,(H,22,23).
What are the key properties of [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-amino-5-bromobenzoate?
[2-(naphthalen-2-ylamino)-2-oxoethyl] 2-amino-5-bromobenzoate has a molecular weight of 399.24 g/mol, XLogP of 3.98, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-amino-5-bromobenzoate is sourced from PubChem (CID 7149341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).