C18H18N2O5 — CID 2582238
[2-(4-methoxyanilino)-2-oxoethyl] 3-acetamidobenzoate (PubChem CID 2582238) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is [2-(4-methoxyanilino)-2-oxoethyl] 3-acetamidobenzoate.
| Compound Name | [2-(4-methoxyanilino)-2-oxoethyl] 3-acetamidobenzoate |
|---|---|
| PubChem CID | 2582238 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | [2-(4-methoxyanilino)-2-oxoethyl] 3-acetamidobenzoate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2cccc(NC(C)=O)c2)cc1 |
| InChI | InChI=1S/C18H18N2O5/c1-12(21)19-15-5-3-4-13(10-15)18(23)25-11-17(22)20-14-6-8-16(24-2)9-7-14/h3-10H,11H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | QRBNKBAAGUVYHY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |