C30H26N4O6S2 — CID 18894029
[2-[[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-[3-(3-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 18894029) has the molecular formula C30H26N4O6S2 and a molecular weight of 602.69 g/mol. Its IUPAC name is [2-[[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-[3-(3-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-[[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-[3-(3-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 18894029 |
| Molecular Formula | C30H26N4O6S2 |
| Molecular Weight | 602.69 g/mol |
| Exact Mass | 602.13 |
| IUPAC Name | [2-[[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-[3-(3-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOc1ccc(-c2csc(NC(=O)COC(=O)c3ccc(N4C(=O)CC(Sc5cccc(N)c5)C4=O)cc3)n2)cc1 |
| InChI | InChI=1S/C30H26N4O6S2/c1-2-39-22-12-8-18(9-13-22)24-17-41-30(32-24)33-26(35)16-40-29(38)19-6-10-21(11-7-19)34-27(36)15-25(28(34)37)42-23-5-3-4-20(31)14-23/h3-14,17,25H,2,15-16,31H2,1H3,(H,32,33,35) |
| InChIKey | LTEBWXOHLDUPSM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 140.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.69 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|