C28H21ClN4O5S2 — CID 18894024
[2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-[3-(3-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 18894024) has the molecular formula C28H21ClN4O5S2 and a molecular weight of 593.09 g/mol. Its IUPAC name is [2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-[3-(3-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-[3-(3-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 18894024 |
| Molecular Formula | C28H21ClN4O5S2 |
| Molecular Weight | 593.09 g/mol |
| Exact Mass | 592.06 |
| IUPAC Name | [2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-[3-(3-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | Nc1cccc(SC2CC(=O)N(c3ccc(C(=O)OCC(=O)Nc4nc(-c5ccc(Cl)cc5)cs4)cc3)C2=O)c1 |
| InChI | InChI=1S/C28H21ClN4O5S2/c29-18-8-4-16(5-9-18)22-15-39-28(31-22)32-24(34)14-38-27(37)17-6-10-20(11-7-17)33-25(35)13-23(26(33)36)40-21-3-1-2-19(30)12-21/h1-12,15,23H,13-14,30H2,(H,31,32,34) |
| InChIKey | GMACDOHATOGDES-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 131.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.09 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|