C17H17NO8S — CID 43860684
2-[1-[2,5-bis(methoxycarbonyl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid (PubChem CID 43860684) has the molecular formula C17H17NO8S and a molecular weight of 395.39 g/mol. Its IUPAC name is 2-[1-[2,5-bis(methoxycarbonyl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid.
| Compound Name | 2-[1-[2,5-bis(methoxycarbonyl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 43860684 |
| Molecular Formula | C17H17NO8S |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 2-[1-[2,5-bis(methoxycarbonyl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(N2C(=O)CC(SC(C)C(=O)O)C2=O)c1 |
| InChI | InChI=1S/C17H17NO8S/c1-8(15(21)22)27-12-7-13(19)18(14(12)20)11-6-9(16(23)25-2)4-5-10(11)17(24)26-3/h4-6,8,12H,7H2,1-3H3,(H,21,22) |
| InChIKey | WBDGPJCZAHGQSW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|