C15H16N2O6S — CID 43843952
3-[3-(2-amino-2-carboxyethyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]-4-methylbenzoic acid (PubChem CID 43843952) has the molecular formula C15H16N2O6S and a molecular weight of 352.37 g/mol. Its IUPAC name is 3-[3-(2-amino-2-carboxyethyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]-4-methylbenzoic acid.
| Compound Name | 3-[3-(2-amino-2-carboxyethyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 43843952 |
| Molecular Formula | C15H16N2O6S |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 3-[3-(2-amino-2-carboxyethyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1N1C(=O)CC(SCC(N)C(=O)O)C1=O |
| InChI | InChI=1S/C15H16N2O6S/c1-7-2-3-8(14(20)21)4-10(7)17-12(18)5-11(13(17)19)24-6-9(16)15(22)23/h2-4,9,11H,5-6,16H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | NXIDAJAGJUBSJQ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|