C14H12ClF3N2O4S — CID 43860508
2-amino-3-[1-[4-chloro-2-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid (PubChem CID 43860508) has the molecular formula C14H12ClF3N2O4S and a molecular weight of 396.77 g/mol. Its IUPAC name is 2-amino-3-[1-[4-chloro-2-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid.
| Compound Name | 2-amino-3-[1-[4-chloro-2-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 43860508 |
| Molecular Formula | C14H12ClF3N2O4S |
| Molecular Weight | 396.77 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 2-amino-3-[1-[4-chloro-2-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
| SMILES | NC(CSC1CC(=O)N(c2ccc(Cl)cc2C(F)(F)F)C1=O)C(=O)O |
| InChI | InChI=1S/C14H12ClF3N2O4S/c15-6-1-2-9(7(3-6)14(16,17)18)20-11(21)4-10(12(20)22)25-5-8(19)13(23)24/h1-3,8,10H,4-5,19H2,(H,23,24) |
| InChIKey | WVCGULRWOPXTLN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.77 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|