C14H14ClNO4S — CID 2978519
3-[1-(4-chloro-2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid (PubChem CID 2978519) has the molecular formula C14H14ClNO4S and a molecular weight of 327.79 g/mol. Its IUPAC name is 3-[1-(4-chloro-2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid.
| Compound Name | 3-[1-(4-chloro-2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 2978519 |
| Molecular Formula | C14H14ClNO4S |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 3-[1-(4-chloro-2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
| SMILES | Cc1cc(Cl)ccc1N1C(=O)CC(SCCC(=O)O)C1=O |
| InChI | InChI=1S/C14H14ClNO4S/c1-8-6-9(15)2-3-10(8)16-12(17)7-11(14(16)20)21-5-4-13(18)19/h2-3,6,11H,4-5,7H2,1H3,(H,18,19) |
| InChIKey | ZUUHSRDHLDHLNT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|