C16H14ClF3N2O5S — CID 43860509
2-acetamido-3-[1-[4-chloro-2-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid (PubChem CID 43860509) has the molecular formula C16H14ClF3N2O5S and a molecular weight of 438.81 g/mol. Its IUPAC name is 2-acetamido-3-[1-[4-chloro-2-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid.
| Compound Name | 2-acetamido-3-[1-[4-chloro-2-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 43860509 |
| Molecular Formula | C16H14ClF3N2O5S |
| Molecular Weight | 438.81 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | 2-acetamido-3-[1-[4-chloro-2-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
| SMILES | CC(=O)NC(CSC1CC(=O)N(c2ccc(Cl)cc2C(F)(F)F)C1=O)C(=O)O |
| InChI | InChI=1S/C16H14ClF3N2O5S/c1-7(23)21-10(15(26)27)6-28-12-5-13(24)22(14(12)25)11-3-2-8(17)4-9(11)16(18,19)20/h2-4,10,12H,5-6H2,1H3,(H,21,23)(H,26,27) |
| InChIKey | GIVVJBFZLZLEKA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.81 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|