C13H14N2O3 — CID 523504
N-(1-methyl-2,6-dioxopiperidin-4-yl)benzamide (PubChem CID 523504) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is N-(1-methyl-2,6-dioxopiperidin-4-yl)benzamide.
| Compound Name | N-(1-methyl-2,6-dioxopiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 523504 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-(1-methyl-2,6-dioxopiperidin-4-yl)benzamide |
| SMILES | CN1C(=O)CC(NC(=O)c2ccccc2)CC1=O |
| InChI | InChI=1S/C13H14N2O3/c1-15-11(16)7-10(8-12(15)17)14-13(18)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3,(H,14,18) |
| InChIKey | FNCVOWZNMJZXIP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|