C12H13N3O3 — CID 76851971
N-(3-methyl-2,6-dioxo-1,3-diazinan-4-yl)benzamide (PubChem CID 76851971) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is N-(3-methyl-2,6-dioxo-1,3-diazinan-4-yl)benzamide.
| Compound Name | N-(3-methyl-2,6-dioxo-1,3-diazinan-4-yl)benzamide |
|---|---|
| PubChem CID | 76851971 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | N-(3-methyl-2,6-dioxo-1,3-diazinan-4-yl)benzamide |
| SMILES | CN1C(=O)NC(=O)CC1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H13N3O3/c1-15-9(7-10(16)14-12(15)18)13-11(17)8-5-3-2-4-6-8/h2-6,9H,7H2,1H3,(H,13,17)(H,14,16,18) |
| InChIKey | DEBLDMVBCWMPKD-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |