C14H17N2O3+ — CID 171580708
methyl-[[2-(1-methyl-2,5-dioxopyrrolidin-3-yl)oxyphenyl]methyl]-methylideneazanium (PubChem CID 171580708) has the molecular formula C14H17N2O3+ and a molecular weight of 261.30 g/mol. Its IUPAC name is methyl-[[2-(1-methyl-2,5-dioxopyrrolidin-3-yl)oxyphenyl]methyl]-methylideneazanium.
| Compound Name | methyl-[[2-(1-methyl-2,5-dioxopyrrolidin-3-yl)oxyphenyl]methyl]-methylideneazanium |
|---|---|
| PubChem CID | 171580708 |
| Molecular Formula | C14H17N2O3+ |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | methyl-[[2-(1-methyl-2,5-dioxopyrrolidin-3-yl)oxyphenyl]methyl]-methylideneazanium |
| SMILES | C=[N+](C)Cc1ccccc1OC1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C14H17N2O3/c1-15(2)9-10-6-4-5-7-11(10)19-12-8-13(17)16(3)14(12)18/h4-7,12H,1,8-9H2,2-3H3/q+1 |
| InChIKey | GTDUDHWKNRZSGR-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|