C20H35NO2S — CID 145169692
ethane;2-methyl-2-methylsulfanylpropane;3-methyl-1-phenylpyrrolidine-2,5-dione (PubChem CID 145169692) has the molecular formula C20H35NO2S and a molecular weight of 353.57 g/mol. Its IUPAC name is ethane;2-methyl-2-methylsulfanylpropane;3-methyl-1-phenylpyrrolidine-2,5-dione.
| Compound Name | ethane;2-methyl-2-methylsulfanylpropane;3-methyl-1-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 145169692 |
| Molecular Formula | C20H35NO2S |
| Molecular Weight | 353.57 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | ethane;2-methyl-2-methylsulfanylpropane;3-methyl-1-phenylpyrrolidine-2,5-dione |
| SMILES | CC.CC.CC1CC(=O)N(c2ccccc2)C1=O.CSC(C)(C)C |
| InChI | InChI=1S/C11H11NO2.C5H12S.2C2H6/c1-8-7-10(13)12(11(8)14)9-5-3-2-4-6-9;1-5(2,3)6-4;2*1-2/h2-6,8H,7H2,1H3;1-4H3;2*1-2H3 |
| InChIKey | WXFKELLQYWWBTO-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.57 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|