C24H21NO3S — CID 7904861
(2-oxo-2-phenothiazin-10-ylethyl) 2-(3,4-dimethylphenyl)acetate (PubChem CID 7904861) has the molecular formula C24H21NO3S and a molecular weight of 403.50 g/mol. Its IUPAC name is (2-oxo-2-phenothiazin-10-ylethyl) 2-(3,4-dimethylphenyl)acetate.
| Compound Name | (2-oxo-2-phenothiazin-10-ylethyl) 2-(3,4-dimethylphenyl)acetate |
|---|---|
| PubChem CID | 7904861 |
| Molecular Formula | C24H21NO3S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | (2-oxo-2-phenothiazin-10-ylethyl) 2-(3,4-dimethylphenyl)acetate |
| SMILES | Cc1ccc(CC(=O)OCC(=O)N2c3ccccc3Sc3ccccc32)cc1C |
| InChI | InChI=1S/C24H21NO3S/c1-16-11-12-18(13-17(16)2)14-24(27)28-15-23(26)25-19-7-3-5-9-21(19)29-22-10-6-4-8-20(22)25/h3-13H,14-15H2,1-2H3 |
| InChIKey | ODVTUTNQBNBFTE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |