C24H22O3 — CID 7904837
[2-oxo-2-(4-phenylphenyl)ethyl] 2-(3,4-dimethylphenyl)acetate (PubChem CID 7904837) has the molecular formula C24H22O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylphenyl)ethyl] 2-(3,4-dimethylphenyl)acetate.
| Compound Name | [2-oxo-2-(4-phenylphenyl)ethyl] 2-(3,4-dimethylphenyl)acetate |
|---|---|
| PubChem CID | 7904837 |
| Molecular Formula | C24H22O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | [2-oxo-2-(4-phenylphenyl)ethyl] 2-(3,4-dimethylphenyl)acetate |
| SMILES | Cc1ccc(CC(=O)OCC(=O)c2ccc(-c3ccccc3)cc2)cc1C |
| InChI | InChI=1S/C24H22O3/c1-17-8-9-19(14-18(17)2)15-24(26)27-16-23(25)22-12-10-21(11-13-22)20-6-4-3-5-7-20/h3-14H,15-16H2,1-2H3 |
| InChIKey | SSHZAIFFTUCPGW-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |