C27H24N2O4S — CID 2536904
(2-oxo-2-phenothiazin-10-ylethyl) (3S)-1-(2-ethylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 2536904) has the molecular formula C27H24N2O4S and a molecular weight of 472.57 g/mol. Its IUPAC name is (2-oxo-2-phenothiazin-10-ylethyl) (3S)-1-(2-ethylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (2-oxo-2-phenothiazin-10-ylethyl) (3S)-1-(2-ethylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 2536904 |
| Molecular Formula | C27H24N2O4S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | (2-oxo-2-phenothiazin-10-ylethyl) (3S)-1-(2-ethylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCc1ccccc1N1C[C@@H](C(=O)OCC(=O)N2c3ccccc3Sc3ccccc32)CC1=O |
| InChI | InChI=1S/C27H24N2O4S/c1-2-18-9-3-4-10-20(18)28-16-19(15-25(28)30)27(32)33-17-26(31)29-21-11-5-7-13-23(21)34-24-14-8-6-12-22(24)29/h3-14,19H,2,15-17H2,1H3/t19-/m0/s1 |
| InChIKey | WERCFMWLQKWGQV-IBGZPJMESA-N |
| XLogP | 4.97 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |