C16H20N2O4 — CID 7798822
[2-(methylamino)-2-oxoethyl] (3R)-1-(2-ethylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 7798822) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] (3R)-1-(2-ethylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-(methylamino)-2-oxoethyl] (3R)-1-(2-ethylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 7798822 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] (3R)-1-(2-ethylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCc1ccccc1N1C[C@H](C(=O)OCC(=O)NC)CC1=O |
| InChI | InChI=1S/C16H20N2O4/c1-3-11-6-4-5-7-13(11)18-9-12(8-15(18)20)16(21)22-10-14(19)17-2/h4-7,12H,3,8-10H2,1-2H3,(H,17,19)/t12-/m1/s1 |
| InChIKey | CKPJRBAVKGRTEF-GFCCVEGCSA-N |
| XLogP | 0.89 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |