C22H30N2O4 — CID 7466578
[2-(cycloheptylamino)-2-oxoethyl] (3S)-1-(2-ethylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 7466578) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is [2-(cycloheptylamino)-2-oxoethyl] (3S)-1-(2-ethylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-(cycloheptylamino)-2-oxoethyl] (3S)-1-(2-ethylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 7466578 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | [2-(cycloheptylamino)-2-oxoethyl] (3S)-1-(2-ethylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCc1ccccc1N1C[C@@H](C(=O)OCC(=O)NC2CCCCCC2)CC1=O |
| InChI | InChI=1S/C22H30N2O4/c1-2-16-9-7-8-12-19(16)24-14-17(13-21(24)26)22(27)28-15-20(25)23-18-10-5-3-4-6-11-18/h7-9,12,17-18H,2-6,10-11,13-15H2,1H3,(H,23,25)/t17-/m0/s1 |
| InChIKey | UTZJBPYQHHJEMZ-KRWDZBQOSA-N |
| XLogP | 2.98 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |