C21H18N2OS — CID 705761
N-[(1S)-1-phenylethyl]phenothiazine-10-carboxamide (PubChem CID 705761) has the molecular formula C21H18N2OS and a molecular weight of 346.46 g/mol. Its IUPAC name is N-[(1S)-1-phenylethyl]phenothiazine-10-carboxamide.
| Compound Name | N-[(1S)-1-phenylethyl]phenothiazine-10-carboxamide |
|---|---|
| PubChem CID | 705761 |
| Molecular Formula | C21H18N2OS |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-[(1S)-1-phenylethyl]phenothiazine-10-carboxamide |
| SMILES | C[C@H](NC(=O)N1c2ccccc2Sc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C21H18N2OS/c1-15(16-9-3-2-4-10-16)22-21(24)23-17-11-5-7-13-19(17)25-20-14-8-6-12-18(20)23/h2-15H,1H3,(H,22,24)/t15-/m0/s1 |
| InChIKey | VILKVBQVVXZVAU-HNNXBMFYSA-N |
| XLogP | 5.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |