C24H23N3O2S — CID 4928336
N'-(4-tert-butylbenzoyl)phenothiazine-10-carbohydrazide (PubChem CID 4928336) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is N'-(4-tert-butylbenzoyl)phenothiazine-10-carbohydrazide.
| Compound Name | N'-(4-tert-butylbenzoyl)phenothiazine-10-carbohydrazide |
|---|---|
| PubChem CID | 4928336 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N'-(4-tert-butylbenzoyl)phenothiazine-10-carbohydrazide |
| SMILES | CC(C)(C)c1ccc(C(=O)NNC(=O)N2c3ccccc3Sc3ccccc32)cc1 |
| InChI | InChI=1S/C24H23N3O2S/c1-24(2,3)17-14-12-16(13-15-17)22(28)25-26-23(29)27-18-8-4-6-10-20(18)30-21-11-7-5-9-19(21)27/h4-15H,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | IRFGHWNRMQHPGC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|