C23H21N3O3S — CID 4928252
N'-[2-(3,5-dimethylphenoxy)acetyl]phenothiazine-10-carbohydrazide (PubChem CID 4928252) has the molecular formula C23H21N3O3S and a molecular weight of 419.51 g/mol. Its IUPAC name is N'-[2-(3,5-dimethylphenoxy)acetyl]phenothiazine-10-carbohydrazide.
| Compound Name | N'-[2-(3,5-dimethylphenoxy)acetyl]phenothiazine-10-carbohydrazide |
|---|---|
| PubChem CID | 4928252 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N'-[2-(3,5-dimethylphenoxy)acetyl]phenothiazine-10-carbohydrazide |
| SMILES | Cc1cc(C)cc(OCC(=O)NNC(=O)N2c3ccccc3Sc3ccccc32)c1 |
| InChI | InChI=1S/C23H21N3O3S/c1-15-11-16(2)13-17(12-15)29-14-22(27)24-25-23(28)26-18-7-3-5-9-20(18)30-21-10-6-4-8-19(21)26/h3-13H,14H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | JSPCCYDCQQAPHY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|