C18H19N3O3S — CID 4504681
N-[[[2-(3,5-dimethylphenoxy)acetyl]amino]carbamothioyl]benzamide (PubChem CID 4504681) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is N-[[[2-(3,5-dimethylphenoxy)acetyl]amino]carbamothioyl]benzamide.
| Compound Name | N-[[[2-(3,5-dimethylphenoxy)acetyl]amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4504681 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N-[[[2-(3,5-dimethylphenoxy)acetyl]amino]carbamothioyl]benzamide |
| SMILES | Cc1cc(C)cc(OCC(=O)NNC(=S)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C18H19N3O3S/c1-12-8-13(2)10-15(9-12)24-11-16(22)20-21-18(25)19-17(23)14-6-4-3-5-7-14/h3-10H,11H2,1-2H3,(H,20,22)(H2,19,21,23,25) |
| InChIKey | KKDQMPBZPGFFSQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|