C22H25N3O3S — CID 9327474
4-tert-butyl-N'-[3-(3-oxo-1,4-benzothiazin-4-yl)propanoyl]benzohydrazide (PubChem CID 9327474) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is 4-tert-butyl-N'-[3-(3-oxo-1,4-benzothiazin-4-yl)propanoyl]benzohydrazide.
| Compound Name | 4-tert-butyl-N'-[3-(3-oxo-1,4-benzothiazin-4-yl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 9327474 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 4-tert-butyl-N'-[3-(3-oxo-1,4-benzothiazin-4-yl)propanoyl]benzohydrazide |
| SMILES | CC(C)(C)c1ccc(C(=O)NNC(=O)CCN2C(=O)CSc3ccccc32)cc1 |
| InChI | InChI=1S/C22H25N3O3S/c1-22(2,3)16-10-8-15(9-11-16)21(28)24-23-19(26)12-13-25-17-6-4-5-7-18(17)29-14-20(25)27/h4-11H,12-14H2,1-3H3,(H,23,26)(H,24,28) |
| InChIKey | RDJNMRGYDUGKJL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|