C21H22N2O4S — CID 27669347
propyl 4-[3-(3-oxo-1,4-benzothiazin-4-yl)propanoylamino]benzoate (PubChem CID 27669347) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is propyl 4-[3-(3-oxo-1,4-benzothiazin-4-yl)propanoylamino]benzoate.
| Compound Name | propyl 4-[3-(3-oxo-1,4-benzothiazin-4-yl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 27669347 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | propyl 4-[3-(3-oxo-1,4-benzothiazin-4-yl)propanoylamino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)CCN2C(=O)CSc3ccccc32)cc1 |
| InChI | InChI=1S/C21H22N2O4S/c1-2-13-27-21(26)15-7-9-16(10-8-15)22-19(24)11-12-23-17-5-3-4-6-18(17)28-14-20(23)25/h3-10H,2,11-14H2,1H3,(H,22,24) |
| InChIKey | JXVQNTCWHVSWPF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |