C13H12ClN5O4 — CID 19298047
[(Z)-[amino-(4-nitrophenyl)methylidene]amino] 3-(4-chloropyrazol-1-yl)propanoate (PubChem CID 19298047) has the molecular formula C13H12ClN5O4 and a molecular weight of 337.72 g/mol. Its IUPAC name is [(Z)-[amino-(4-nitrophenyl)methylidene]amino] 3-(4-chloropyrazol-1-yl)propanoate.
| Compound Name | [(Z)-[amino-(4-nitrophenyl)methylidene]amino] 3-(4-chloropyrazol-1-yl)propanoate |
|---|---|
| PubChem CID | 19298047 |
| Molecular Formula | C13H12ClN5O4 |
| Molecular Weight | 337.72 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | [(Z)-[amino-(4-nitrophenyl)methylidene]amino] 3-(4-chloropyrazol-1-yl)propanoate |
| SMILES | N/C(=N\OC(=O)CCn1cc(Cl)cn1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H12ClN5O4/c14-10-7-16-18(8-10)6-5-12(20)23-17-13(15)9-1-3-11(4-2-9)19(21)22/h1-4,7-8H,5-6H2,(H2,15,17) |
| InChIKey | DFCZRLVVCJIUJH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.72 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|