C14H13N5O4 — CID 19582257
[(Z)-[amino-(4-nitrophenyl)methylidene]amino] (E)-3-(1-methylpyrazol-4-yl)prop-2-enoate (PubChem CID 19582257) has the molecular formula C14H13N5O4 and a molecular weight of 315.29 g/mol. Its IUPAC name is [(Z)-[amino-(4-nitrophenyl)methylidene]amino] (E)-3-(1-methylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [(Z)-[amino-(4-nitrophenyl)methylidene]amino] (E)-3-(1-methylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 19582257 |
| Molecular Formula | C14H13N5O4 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | [(Z)-[amino-(4-nitrophenyl)methylidene]amino] (E)-3-(1-methylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cn1cc(/C=C/C(=O)O/N=C(\N)c2ccc([N+](=O)[O-])cc2)cn1 |
| InChI | InChI=1S/C14H13N5O4/c1-18-9-10(8-16-18)2-7-13(20)23-17-14(15)11-3-5-12(6-4-11)19(21)22/h2-9H,1H3,(H2,15,17)/b7-2+ |
| InChIKey | PHRLFJUGJFKNOG-FARCUNLSSA-N |
| XLogP | 1.21 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|