C13H10ClN5O3 — CID 19539686
3-(4-chloropyrazol-1-yl)-N-(2-cyano-4-nitrophenyl)propanamide (PubChem CID 19539686) has the molecular formula C13H10ClN5O3 and a molecular weight of 319.71 g/mol. Its IUPAC name is 3-(4-chloropyrazol-1-yl)-N-(2-cyano-4-nitrophenyl)propanamide.
| Compound Name | 3-(4-chloropyrazol-1-yl)-N-(2-cyano-4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 19539686 |
| Molecular Formula | C13H10ClN5O3 |
| Molecular Weight | 319.71 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 3-(4-chloropyrazol-1-yl)-N-(2-cyano-4-nitrophenyl)propanamide |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NC(=O)CCn1cc(Cl)cn1 |
| InChI | InChI=1S/C13H10ClN5O3/c14-10-7-16-18(8-10)4-3-13(20)17-12-2-1-11(19(21)22)5-9(12)6-15/h1-2,5,7-8H,3-4H2,(H,17,20) |
| InChIKey | MMCHJCNVRYCZIS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 113.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.71 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|