C16H16ClF3N4O3 — CID 19296053
[(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propanoate (PubChem CID 19296053) has the molecular formula C16H16ClF3N4O3 and a molecular weight of 404.78 g/mol. Its IUPAC name is [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propanoate.
| Compound Name | [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propanoate |
|---|---|
| PubChem CID | 19296053 |
| Molecular Formula | C16H16ClF3N4O3 |
| Molecular Weight | 404.78 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propanoate |
| SMILES | COc1ccc(Cl)cc1/C(N)=N/OC(=O)CCn1nc(C(F)(F)F)cc1C |
| InChI | InChI=1S/C16H16ClF3N4O3/c1-9-7-13(16(18,19)20)22-24(9)6-5-14(25)27-23-15(21)11-8-10(17)3-4-12(11)26-2/h3-4,7-8H,5-6H2,1-2H3,(H2,21,23) |
| InChIKey | QYIBHPRYVIMNFX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.78 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|