C19H17BrClN5O3 — CID 19294136
[(Z)-[amino-(3-amino-2-methylphenyl)methylidene]amino] 1-[(4-bromo-2-chlorophenoxy)methyl]pyrazole-3-carboxylate (PubChem CID 19294136) has the molecular formula C19H17BrClN5O3 and a molecular weight of 478.73 g/mol. Its IUPAC name is [(Z)-[amino-(3-amino-2-methylphenyl)methylidene]amino] 1-[(4-bromo-2-chlorophenoxy)methyl]pyrazole-3-carboxylate.
| Compound Name | [(Z)-[amino-(3-amino-2-methylphenyl)methylidene]amino] 1-[(4-bromo-2-chlorophenoxy)methyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 19294136 |
| Molecular Formula | C19H17BrClN5O3 |
| Molecular Weight | 478.73 g/mol |
| Exact Mass | 477.02 |
| IUPAC Name | [(Z)-[amino-(3-amino-2-methylphenyl)methylidene]amino] 1-[(4-bromo-2-chlorophenoxy)methyl]pyrazole-3-carboxylate |
| SMILES | Cc1c(N)cccc1/C(N)=N/OC(=O)c1ccn(COc2ccc(Br)cc2Cl)n1 |
| InChI | InChI=1S/C19H17BrClN5O3/c1-11-13(3-2-4-15(11)22)18(23)25-29-19(27)16-7-8-26(24-16)10-28-17-6-5-12(20)9-14(17)21/h2-9H,10,22H2,1H3,(H2,23,25) |
| InChIKey | CVXVRTSUDHZFEM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.73 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|