C19H18Cl2F2O3 — CID 162522765
3-[3,5-dichloro-2-fluoro-4-[(2-fluoro-4-hydroxy-3-propan-2-ylphenyl)methyl]phenyl]propanoic acid (PubChem CID 162522765) has the molecular formula C19H18Cl2F2O3 and a molecular weight of 403.25 g/mol. Its IUPAC name is 3-[3,5-dichloro-2-fluoro-4-[(2-fluoro-4-hydroxy-3-propan-2-ylphenyl)methyl]phenyl]propanoic acid.
| Compound Name | 3-[3,5-dichloro-2-fluoro-4-[(2-fluoro-4-hydroxy-3-propan-2-ylphenyl)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 162522765 |
| Molecular Formula | C19H18Cl2F2O3 |
| Molecular Weight | 403.25 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 3-[3,5-dichloro-2-fluoro-4-[(2-fluoro-4-hydroxy-3-propan-2-ylphenyl)methyl]phenyl]propanoic acid |
| SMILES | CC(C)c1c(O)ccc(Cc2c(Cl)cc(CCC(=O)O)c(F)c2Cl)c1F |
| InChI | InChI=1S/C19H18Cl2F2O3/c1-9(2)16-14(24)5-3-10(18(16)22)7-12-13(20)8-11(4-6-15(25)26)19(23)17(12)21/h3,5,8-9,24H,4,6-7H2,1-2H3,(H,25,26) |
| InChIKey | LFQGGRWJVWFGNO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.25 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|