C10H8ClF3O3 — CID 75529973
1-[5-chloro-2-(methoxymethoxy)phenyl]-2,2,2-trifluoroethanone (PubChem CID 75529973) has the molecular formula C10H8ClF3O3 and a molecular weight of 268.62 g/mol. Its IUPAC name is 1-[5-chloro-2-(methoxymethoxy)phenyl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[5-chloro-2-(methoxymethoxy)phenyl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 75529973 |
| Molecular Formula | C10H8ClF3O3 |
| Molecular Weight | 268.62 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 1-[5-chloro-2-(methoxymethoxy)phenyl]-2,2,2-trifluoroethanone |
| SMILES | COCOc1ccc(Cl)cc1C(=O)C(F)(F)F |
| InChI | InChI=1S/C10H8ClF3O3/c1-16-5-17-8-3-2-6(11)4-7(8)9(15)10(12,13)14/h2-4H,5H2,1H3 |
| InChIKey | MOWXSUDMCDBKPG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.62 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|