C16H15ClF3NO3 — CID 90122845
5-[5-chloro-2-(2-methoxyethoxymethoxy)phenyl]-2-(trifluoromethyl)pyridine (PubChem CID 90122845) has the molecular formula C16H15ClF3NO3 and a molecular weight of 361.75 g/mol. Its IUPAC name is 5-[5-chloro-2-(2-methoxyethoxymethoxy)phenyl]-2-(trifluoromethyl)pyridine.
| Compound Name | 5-[5-chloro-2-(2-methoxyethoxymethoxy)phenyl]-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 90122845 |
| Molecular Formula | C16H15ClF3NO3 |
| Molecular Weight | 361.75 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 5-[5-chloro-2-(2-methoxyethoxymethoxy)phenyl]-2-(trifluoromethyl)pyridine |
| SMILES | COCCOCOc1ccc(Cl)cc1-c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C16H15ClF3NO3/c1-22-6-7-23-10-24-14-4-3-12(17)8-13(14)11-2-5-15(21-9-11)16(18,19)20/h2-5,8-9H,6-7,10H2,1H3 |
| InChIKey | HWIDZCFMBPKDQL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.75 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|