C16H15ClF3N3O2 — CID 154837822
1-[1-(3-chlorophenyl)-2-methoxyethyl]-3-[6-(trifluoromethyl)-3-pyridinyl]urea (PubChem CID 154837822) has the molecular formula C16H15ClF3N3O2 and a molecular weight of 373.76 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)-2-methoxyethyl]-3-[6-(trifluoromethyl)-3-pyridinyl]urea.
| Compound Name | 1-[1-(3-chlorophenyl)-2-methoxyethyl]-3-[6-(trifluoromethyl)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 154837822 |
| Molecular Formula | C16H15ClF3N3O2 |
| Molecular Weight | 373.76 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 1-[1-(3-chlorophenyl)-2-methoxyethyl]-3-[6-(trifluoromethyl)-3-pyridinyl]urea |
| SMILES | COCC(NC(=O)Nc1ccc(C(F)(F)F)nc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H15ClF3N3O2/c1-25-9-13(10-3-2-4-11(17)7-10)23-15(24)22-12-5-6-14(21-8-12)16(18,19)20/h2-8,13H,9H2,1H3,(H2,22,23,24) |
| InChIKey | FSOHFFPHSNVBJE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.76 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |