C14H16F3N5O — CID 99583562
1-[(2S)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]-3-[6-(trifluoromethyl)-3-pyridinyl]urea (PubChem CID 99583562) has the molecular formula C14H16F3N5O and a molecular weight of 327.31 g/mol. Its IUPAC name is 1-[(2S)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]-3-[6-(trifluoromethyl)-3-pyridinyl]urea.
| Compound Name | 1-[(2S)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]-3-[6-(trifluoromethyl)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 99583562 |
| Molecular Formula | C14H16F3N5O |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1-[(2S)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]-3-[6-(trifluoromethyl)-3-pyridinyl]urea |
| SMILES | Cc1cc(C[C@H](C)NC(=O)Nc2ccc(C(F)(F)F)nc2)n[nH]1 |
| InChI | InChI=1S/C14H16F3N5O/c1-8(5-11-6-9(2)21-22-11)19-13(23)20-10-3-4-12(18-7-10)14(15,16)17/h3-4,6-8H,5H2,1-2H3,(H,21,22)(H2,19,20,23)/t8-/m0/s1 |
| InChIKey | KDVULGHHAHEGOL-QMMMGPOBSA-N |
| XLogP | 2.88 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |