C14H21N7O — CID 99581238
1-[2-(dimethylamino)pyrimidin-5-yl]-3-[(2R)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]urea (PubChem CID 99581238) has the molecular formula C14H21N7O and a molecular weight of 303.37 g/mol. Its IUPAC name is 1-[2-(dimethylamino)pyrimidin-5-yl]-3-[(2R)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]urea.
| Compound Name | 1-[2-(dimethylamino)pyrimidin-5-yl]-3-[(2R)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]urea |
|---|---|
| PubChem CID | 99581238 |
| Molecular Formula | C14H21N7O |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 1-[2-(dimethylamino)pyrimidin-5-yl]-3-[(2R)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]urea |
| SMILES | Cc1cc(C[C@@H](C)NC(=O)Nc2cnc(N(C)C)nc2)n[nH]1 |
| InChI | InChI=1S/C14H21N7O/c1-9(5-11-6-10(2)19-20-11)17-14(22)18-12-7-15-13(16-8-12)21(3)4/h6-9H,5H2,1-4H3,(H,19,20)(H2,17,18,22)/t9-/m1/s1 |
| InChIKey | CYASOYUDZSRFDM-SECBINFHSA-N |
| XLogP | 1.33 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |