C16H22ClN5O — CID 99714466
1-[5-chloro-2-(dimethylamino)phenyl]-3-[(2R)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]urea (PubChem CID 99714466) has the molecular formula C16H22ClN5O and a molecular weight of 335.84 g/mol. Its IUPAC name is 1-[5-chloro-2-(dimethylamino)phenyl]-3-[(2R)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]urea.
| Compound Name | 1-[5-chloro-2-(dimethylamino)phenyl]-3-[(2R)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]urea |
|---|---|
| PubChem CID | 99714466 |
| Molecular Formula | C16H22ClN5O |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 1-[5-chloro-2-(dimethylamino)phenyl]-3-[(2R)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]urea |
| SMILES | Cc1cc(C[C@@H](C)NC(=O)Nc2cc(Cl)ccc2N(C)C)n[nH]1 |
| InChI | InChI=1S/C16H22ClN5O/c1-10(7-13-8-11(2)20-21-13)18-16(23)19-14-9-12(17)5-6-15(14)22(3)4/h5-6,8-10H,7H2,1-4H3,(H,20,21)(H2,18,19,23)/t10-/m1/s1 |
| InChIKey | AZSRHGSOPZEQTO-SNVBAGLBSA-N |
| XLogP | 3.19 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |