C18H19FN4O2 — CID 99856240
1-[2-fluoro-5-(furan-2-yl)phenyl]-3-[(2R)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]urea (PubChem CID 99856240) has the molecular formula C18H19FN4O2 and a molecular weight of 342.37 g/mol. Its IUPAC name is 1-[2-fluoro-5-(furan-2-yl)phenyl]-3-[(2R)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]urea.
| Compound Name | 1-[2-fluoro-5-(furan-2-yl)phenyl]-3-[(2R)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]urea |
|---|---|
| PubChem CID | 99856240 |
| Molecular Formula | C18H19FN4O2 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 1-[2-fluoro-5-(furan-2-yl)phenyl]-3-[(2R)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]urea |
| SMILES | Cc1cc(C[C@@H](C)NC(=O)Nc2cc(-c3ccco3)ccc2F)n[nH]1 |
| InChI | InChI=1S/C18H19FN4O2/c1-11(8-14-9-12(2)22-23-14)20-18(24)21-16-10-13(5-6-15(16)19)17-4-3-7-25-17/h3-7,9-11H,8H2,1-2H3,(H,22,23)(H2,20,21,24)/t11-/m1/s1 |
| InChIKey | YIHHJYOTHPLGGL-LLVKDONJSA-N |
| XLogP | 3.87 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |