C14H17FN4O — CID 97069201
1-(3-fluorophenyl)-3-[(2S)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]urea (PubChem CID 97069201) has the molecular formula C14H17FN4O and a molecular weight of 276.31 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[(2S)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]urea.
| Compound Name | 1-(3-fluorophenyl)-3-[(2S)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]urea |
|---|---|
| PubChem CID | 97069201 |
| Molecular Formula | C14H17FN4O |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[(2S)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]urea |
| SMILES | Cc1cc(C[C@H](C)NC(=O)Nc2cccc(F)c2)n[nH]1 |
| InChI | InChI=1S/C14H17FN4O/c1-9(6-13-7-10(2)18-19-13)16-14(20)17-12-5-3-4-11(15)8-12/h3-5,7-9H,6H2,1-2H3,(H,18,19)(H2,16,17,20)/t9-/m0/s1 |
| InChIKey | YANHLNGLUVXAKR-VIFPVBQESA-N |
| XLogP | 2.61 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |