C14H19N5O — CID 99595123
1-[(2S)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]-3-(5-methyl-2-pyridinyl)urea (PubChem CID 99595123) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is 1-[(2S)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]-3-(5-methyl-2-pyridinyl)urea.
| Compound Name | 1-[(2S)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]-3-(5-methyl-2-pyridinyl)urea |
|---|---|
| PubChem CID | 99595123 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 1-[(2S)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]-3-(5-methyl-2-pyridinyl)urea |
| SMILES | Cc1ccc(NC(=O)N[C@@H](C)Cc2cc(C)[nH]n2)nc1 |
| InChI | InChI=1S/C14H19N5O/c1-9-4-5-13(15-8-9)17-14(20)16-10(2)6-12-7-11(3)18-19-12/h4-5,7-8,10H,6H2,1-3H3,(H,18,19)(H2,15,16,17,20)/t10-/m0/s1 |
| InChIKey | LROKUABXPWIPPB-JTQLQIEISA-N |
| XLogP | 2.17 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |