C15H16FN5O — CID 99715677
1-(2-cyano-4-fluorophenyl)-3-[(2S)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]urea (PubChem CID 99715677) has the molecular formula C15H16FN5O and a molecular weight of 301.33 g/mol. Its IUPAC name is 1-(2-cyano-4-fluorophenyl)-3-[(2S)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]urea.
| Compound Name | 1-(2-cyano-4-fluorophenyl)-3-[(2S)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]urea |
|---|---|
| PubChem CID | 99715677 |
| Molecular Formula | C15H16FN5O |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 1-(2-cyano-4-fluorophenyl)-3-[(2S)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]urea |
| SMILES | Cc1cc(C[C@H](C)NC(=O)Nc2ccc(F)cc2C#N)n[nH]1 |
| InChI | InChI=1S/C15H16FN5O/c1-9(5-13-6-10(2)20-21-13)18-15(22)19-14-4-3-12(16)7-11(14)8-17/h3-4,6-7,9H,5H2,1-2H3,(H,20,21)(H2,18,19,22)/t9-/m0/s1 |
| InChIKey | KYUKAFLDABPHFD-VIFPVBQESA-N |
| XLogP | 2.48 |
| TPSA | 93.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |