C14H12F3N3O2 — CID 122133943
1-[(3-hydroxyphenyl)methyl]-3-[6-(trifluoromethyl)-3-pyridinyl]urea (PubChem CID 122133943) has the molecular formula C14H12F3N3O2 and a molecular weight of 311.26 g/mol. Its IUPAC name is 1-[(3-hydroxyphenyl)methyl]-3-[6-(trifluoromethyl)-3-pyridinyl]urea.
| Compound Name | 1-[(3-hydroxyphenyl)methyl]-3-[6-(trifluoromethyl)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 122133943 |
| Molecular Formula | C14H12F3N3O2 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 1-[(3-hydroxyphenyl)methyl]-3-[6-(trifluoromethyl)-3-pyridinyl]urea |
| SMILES | O=C(NCc1cccc(O)c1)Nc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C14H12F3N3O2/c15-14(16,17)12-5-4-10(8-18-12)20-13(22)19-7-9-2-1-3-11(21)6-9/h1-6,8,21H,7H2,(H2,19,20,22) |
| InChIKey | PAOUGRQDWXQWDT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |