C14H14N2O4 — CID 71045044
1-(3,4-dihydroxyphenyl)-3-[(3-hydroxyphenyl)methyl]urea (PubChem CID 71045044) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-3-[(3-hydroxyphenyl)methyl]urea.
| Compound Name | 1-(3,4-dihydroxyphenyl)-3-[(3-hydroxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 71045044 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-3-[(3-hydroxyphenyl)methyl]urea |
| SMILES | O=C(NCc1cccc(O)c1)Nc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H14N2O4/c17-11-3-1-2-9(6-11)8-15-14(20)16-10-4-5-12(18)13(19)7-10/h1-7,17-19H,8H2,(H2,15,16,20) |
| InChIKey | PIHRCZAGIIZUOC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|