C15H16ClN3OS — CID 60603062
1-[(3-chlorophenyl)methyl]-3-(6-ethylsulfanyl-3-pyridinyl)urea (PubChem CID 60603062) has the molecular formula C15H16ClN3OS and a molecular weight of 321.83 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-(6-ethylsulfanyl-3-pyridinyl)urea.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-(6-ethylsulfanyl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 60603062 |
| Molecular Formula | C15H16ClN3OS |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-(6-ethylsulfanyl-3-pyridinyl)urea |
| SMILES | CCSc1ccc(NC(=O)NCc2cccc(Cl)c2)cn1 |
| InChI | InChI=1S/C15H16ClN3OS/c1-2-21-14-7-6-13(10-17-14)19-15(20)18-9-11-4-3-5-12(16)8-11/h3-8,10H,2,9H2,1H3,(H2,18,19,20) |
| InChIKey | CPICFHGNRNKPCO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |