C16H11F6IN2O — CID 3739428
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(3-iodophenyl)methyl]urea (PubChem CID 3739428) has the molecular formula C16H11F6IN2O and a molecular weight of 488.17 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(3-iodophenyl)methyl]urea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(3-iodophenyl)methyl]urea |
|---|---|
| PubChem CID | 3739428 |
| Molecular Formula | C16H11F6IN2O |
| Molecular Weight | 488.17 g/mol |
| Exact Mass | 487.98 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(3-iodophenyl)methyl]urea |
| SMILES | O=C(NCc1cccc(I)c1)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H11F6IN2O/c17-15(18,19)10-5-11(16(20,21)22)7-13(6-10)25-14(26)24-8-9-2-1-3-12(23)4-9/h1-7H,8H2,(H2,24,25,26) |
| InChIKey | MPUIFQODFZYYIB-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.17 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|