C17H19IN2O — CID 3868878
1-[(3-iodophenyl)methyl]-3-(2-propan-2-ylphenyl)urea (PubChem CID 3868878) has the molecular formula C17H19IN2O and a molecular weight of 394.26 g/mol. Its IUPAC name is 1-[(3-iodophenyl)methyl]-3-(2-propan-2-ylphenyl)urea.
| Compound Name | 1-[(3-iodophenyl)methyl]-3-(2-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 3868878 |
| Molecular Formula | C17H19IN2O |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 1-[(3-iodophenyl)methyl]-3-(2-propan-2-ylphenyl)urea |
| SMILES | CC(C)c1ccccc1NC(=O)NCc1cccc(I)c1 |
| InChI | InChI=1S/C17H19IN2O/c1-12(2)15-8-3-4-9-16(15)20-17(21)19-11-13-6-5-7-14(18)10-13/h3-10,12H,11H2,1-2H3,(H2,19,20,21) |
| InChIKey | SSVRPBRHDNOGRR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|