C20H25IN2O — CID 3677795
1-[2,6-di(propan-2-yl)phenyl]-3-[(3-iodophenyl)methyl]urea (PubChem CID 3677795) has the molecular formula C20H25IN2O and a molecular weight of 436.34 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-[(3-iodophenyl)methyl]urea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[(3-iodophenyl)methyl]urea |
|---|---|
| PubChem CID | 3677795 |
| Molecular Formula | C20H25IN2O |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[(3-iodophenyl)methyl]urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NCc1cccc(I)c1 |
| InChI | InChI=1S/C20H25IN2O/c1-13(2)17-9-6-10-18(14(3)4)19(17)23-20(24)22-12-15-7-5-8-16(21)11-15/h5-11,13-14H,12H2,1-4H3,(H2,22,23,24) |
| InChIKey | DZNQTVKZPUBBQH-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|