C16H23F3N2O3 — CID 111455621
1-(4-hydroxy-3-methylbutan-2-yl)-3-[2-methoxy-1-[3-(trifluoromethyl)phenyl]ethyl]urea (PubChem CID 111455621) has the molecular formula C16H23F3N2O3 and a molecular weight of 348.37 g/mol. Its IUPAC name is 1-(4-hydroxy-3-methylbutan-2-yl)-3-[2-methoxy-1-[3-(trifluoromethyl)phenyl]ethyl]urea.
| Compound Name | 1-(4-hydroxy-3-methylbutan-2-yl)-3-[2-methoxy-1-[3-(trifluoromethyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 111455621 |
| Molecular Formula | C16H23F3N2O3 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 1-(4-hydroxy-3-methylbutan-2-yl)-3-[2-methoxy-1-[3-(trifluoromethyl)phenyl]ethyl]urea |
| SMILES | COCC(NC(=O)NC(C)C(C)CO)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H23F3N2O3/c1-10(8-22)11(2)20-15(23)21-14(9-24-3)12-5-4-6-13(7-12)16(17,18)19/h4-7,10-11,14,22H,8-9H2,1-3H3,(H2,20,21,23) |
| InChIKey | KXWRJEZFFCIFIG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |