C19H21F3N2O2 — CID 86971896
N-[2-methoxy-1-[3-(trifluoromethyl)phenyl]ethyl]-2-(N-methylanilino)acetamide (PubChem CID 86971896) has the molecular formula C19H21F3N2O2 and a molecular weight of 366.38 g/mol. Its IUPAC name is N-[2-methoxy-1-[3-(trifluoromethyl)phenyl]ethyl]-2-(N-methylanilino)acetamide.
| Compound Name | N-[2-methoxy-1-[3-(trifluoromethyl)phenyl]ethyl]-2-(N-methylanilino)acetamide |
|---|---|
| PubChem CID | 86971896 |
| Molecular Formula | C19H21F3N2O2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N-[2-methoxy-1-[3-(trifluoromethyl)phenyl]ethyl]-2-(N-methylanilino)acetamide |
| SMILES | COCC(NC(=O)CN(C)c1ccccc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H21F3N2O2/c1-24(16-9-4-3-5-10-16)12-18(25)23-17(13-26-2)14-7-6-8-15(11-14)19(20,21)22/h3-11,17H,12-13H2,1-2H3,(H,23,25) |
| InChIKey | XTOWALZZDNTJQT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |